C25H30F3NO3 — CID 161104243
4-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-3-(trifluoromethoxy)phenol (PubChem CID 161104243) has the molecular formula C25H30F3NO3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 4-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-3-(trifluoromethoxy)phenol.
| Compound Name | 4-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-3-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 161104243 |
| Molecular Formula | C25H30F3NO3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 4-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-3-(trifluoromethoxy)phenol |
| SMILES | Oc1ccc(CCCCC2(c3ccccn3)CCOC3(CCCC3)C2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C25H30F3NO3/c26-25(27,28)32-21-17-20(30)10-9-19(21)7-1-3-11-23(22-8-2-6-15-29-22)14-16-31-24(18-23)12-4-5-13-24/h2,6,8-10,15,17,30H,1,3-5,7,11-14,16,18H2 |
| InChIKey | UIVJDNDNBROYMY-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|