C23H28F3N3O — CID 159111956
5-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-2-(trifluoromethyl)pyrimidine (PubChem CID 159111956) has the molecular formula C23H28F3N3O and a molecular weight of 419.49 g/mol. Its IUPAC name is 5-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-2-(trifluoromethyl)pyrimidine.
| Compound Name | 5-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 159111956 |
| Molecular Formula | C23H28F3N3O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 5-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-2-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1ncc(CCCCC2(c3ccccn3)CCOC3(CCCC3)C2)cn1 |
| InChI | InChI=1S/C23H28F3N3O/c24-23(25,26)20-28-15-18(16-29-20)7-1-3-9-21(19-8-2-6-13-27-19)12-14-30-22(17-21)10-4-5-11-22/h2,6,8,13,15-16H,1,3-5,7,9-12,14,17H2 |
| InChIKey | KEPNHAYLHBAOHV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|