C22H20ClFN2O4S — CID 148709114
(3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-7-hex-5-ynoyl-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 148709114) has the molecular formula C22H20ClFN2O4S and a molecular weight of 462.93 g/mol. Its IUPAC name is (3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-7-hex-5-ynoyl-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-7-hex-5-ynoyl-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 148709114 |
| Molecular Formula | C22H20ClFN2O4S |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-7-hex-5-ynoyl-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | C#CCCCC(=O)c1cc2c(cc1F)S(=O)(=O)C[C@H](N)C(=O)N2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClFN2O4S/c1-2-3-4-5-20(27)16-10-19-21(11-17(16)24)31(29,30)13-18(25)22(28)26(19)12-14-6-8-15(23)9-7-14/h1,6-11,18H,3-5,12-13,25H2/t18-/m0/s1 |
| InChIKey | NWWKEWAMJSMOLV-SFHVURJKSA-N |
| XLogP | 3.11 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|