C26H23ClFN3O4S — CID 137357972
3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-N-[(1S,2R)-2-phenylcyclopropyl]-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide (PubChem CID 137357972) has the molecular formula C26H23ClFN3O4S and a molecular weight of 528.01 g/mol. Its IUPAC name is 3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-N-[(1S,2R)-2-phenylcyclopropyl]-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide.
| Compound Name | 3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-N-[(1S,2R)-2-phenylcyclopropyl]-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 137357972 |
| Molecular Formula | C26H23ClFN3O4S |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-N-[(1S,2R)-2-phenylcyclopropyl]-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide |
| SMILES | NC1CS(=O)(=O)c2cc(F)c(C(=O)N[C@H]3C[C@@H]3c3ccccc3)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C26H23ClFN3O4S/c27-17-8-6-15(7-9-17)13-31-23-11-19(20(28)12-24(23)36(34,35)14-21(29)26(31)33)25(32)30-22-10-18(22)16-4-2-1-3-5-16/h1-9,11-12,18,21-22H,10,13-14,29H2,(H,30,32)/t18-,21?,22+/m1/s1 |
| InChIKey | VZAMEJDWNKQINX-BYHNSMNUSA-N |
| XLogP | 3.41 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |