C25H26ClF4N3O6S — CID 134609127
tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-7-(3,3,3-trifluoropropylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate (PubChem CID 134609127) has the molecular formula C25H26ClF4N3O6S and a molecular weight of 608.01 g/mol. Its IUPAC name is tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-7-(3,3,3-trifluoropropylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-7-(3,3,3-trifluoropropylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 134609127 |
| Molecular Formula | C25H26ClF4N3O6S |
| Molecular Weight | 608.01 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-7-(3,3,3-trifluoropropylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CS(=O)(=O)c2cc(F)c(C(=O)NCCC(F)(F)F)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C25H26ClF4N3O6S/c1-24(2,3)39-23(36)32-18-13-40(37,38)20-11-17(27)16(21(34)31-9-8-25(28,29)30)10-19(20)33(22(18)35)12-14-4-6-15(26)7-5-14/h4-7,10-11,18H,8-9,12-13H2,1-3H3,(H,31,34)(H,32,36)/t18-/m0/s1 |
| InChIKey | DNHRVXSYZXZPMC-SFHVURJKSA-N |
| XLogP | 4.38 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.01 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |