C22H24ClN3O7S — CID 145147812
tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-7-(hydroxycarbamoyl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate (PubChem CID 145147812) has the molecular formula C22H24ClN3O7S and a molecular weight of 509.97 g/mol. Its IUPAC name is tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-7-(hydroxycarbamoyl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-7-(hydroxycarbamoyl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 145147812 |
| Molecular Formula | C22H24ClN3O7S |
| Molecular Weight | 509.97 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-7-(hydroxycarbamoyl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CS(=O)(=O)c2ccc(C(=O)NO)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C22H24ClN3O7S/c1-22(2,3)33-21(29)24-16-12-34(31,32)18-9-6-14(19(27)25-30)10-17(18)26(20(16)28)11-13-4-7-15(23)8-5-13/h4-10,16,30H,11-12H2,1-3H3,(H,24,29)(H,25,27)/t16-/m0/s1 |
| InChIKey | PYKJTVNSVSFQPO-INIZCTEOSA-N |
| XLogP | 2.67 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.97 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|