C29H32F2N2O6S — CID 162256098
tert-butyl N-[(3R)-5-[(4-cyclopropylphenyl)methyl]-7-[2-[(1R)-2,2-difluorocyclopropyl]acetyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate (PubChem CID 162256098) has the molecular formula C29H32F2N2O6S and a molecular weight of 574.65 g/mol. Its IUPAC name is tert-butyl N-[(3R)-5-[(4-cyclopropylphenyl)methyl]-7-[2-[(1R)-2,2-difluorocyclopropyl]acetyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-5-[(4-cyclopropylphenyl)methyl]-7-[2-[(1R)-2,2-difluorocyclopropyl]acetyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 162256098 |
| Molecular Formula | C29H32F2N2O6S |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | tert-butyl N-[(3R)-5-[(4-cyclopropylphenyl)methyl]-7-[2-[(1R)-2,2-difluorocyclopropyl]acetyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CS(=O)(=O)c2ccc(C(=O)C[C@@H]3CC3(F)F)cc2N(Cc2ccc(C3CC3)cc2)C1=O |
| InChI | InChI=1S/C29H32F2N2O6S/c1-28(2,3)39-27(36)32-22-16-40(37,38)25-11-10-20(24(34)13-21-14-29(21,30)31)12-23(25)33(26(22)35)15-17-4-6-18(7-5-17)19-8-9-19/h4-7,10-12,19,21-22H,8-9,13-16H2,1-3H3,(H,32,36)/t21-,22+/m1/s1 |
| InChIKey | ZYPQGCANCFUUFA-YADHBBJMSA-N |
| XLogP | 5.01 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |