C28H31F3N4O7S — CID 164873841
tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1,4-trioxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate (PubChem CID 164873841) has the molecular formula C28H31F3N4O7S and a molecular weight of 624.64 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1,4-trioxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1,4-trioxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 164873841 |
| Molecular Formula | C28H31F3N4O7S |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1,4-trioxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CS(=O)(=O)c2ccc(-c3nnc(C(C)(C)C)o3)cc2N(Cc2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C28H31F3N4O7S/c1-26(2,3)24-34-33-22(40-24)17-9-12-21-20(13-17)35(14-16-7-10-18(11-8-16)41-28(29,30)31)23(36)19(15-43(21,38)39)32-25(37)42-27(4,5)6/h7-13,19H,14-15H2,1-6H3,(H,32,37)/t19-/m0/s1 |
| InChIKey | JFBRFXZDHYQRLM-IBGZPJMESA-N |
| XLogP | 5.15 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |