C30H39F3N4O6S — CID 164874167
tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(1,1-difluoroethoxy)phenyl]methyl]-8-fluoro-1-methylidene-1,4-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate;molecular hydrogen (PubChem CID 164874167) has the molecular formula C30H39F3N4O6S and a molecular weight of 640.73 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(1,1-difluoroethoxy)phenyl]methyl]-8-fluoro-1-methylidene-1,4-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(1,1-difluoroethoxy)phenyl]methyl]-8-fluoro-1-methylidene-1,4-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 164874167 |
| Molecular Formula | C30H39F3N4O6S |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[[4-(1,1-difluoroethoxy)phenyl]methyl]-8-fluoro-1-methylidene-1,4-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate;molecular hydrogen |
| SMILES | C=S1(=O)C[C@H](NC(=O)OC(C)(C)C)C(=O)N(Cc2ccc(OC(C)(F)F)cc2)c2cc(-c3nnc(C(C)(C)C)o3)c(F)cc21.[H][H].[H][H] |
| InChI | InChI=1S/C30H35F3N4O6S.2H2/c1-28(2,3)26-36-35-24(41-26)19-13-22-23(14-20(19)31)44(8,40)16-21(34-27(39)43-29(4,5)6)25(38)37(22)15-17-9-11-18(12-10-17)42-30(7,32)33;;/h9-14,21H,8,15-16H2,1-7H3,(H,34,39);2*1H/t21-,44?;;/m0../s1 |
| InChIKey | MGMYMLIMYXDCNY-ZJEMTAABSA-N |
| XLogP | 6.17 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|