C29H32F4N4O5S — CID 164874512
tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-4-oxo-5-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate (PubChem CID 164874512) has the molecular formula C29H32F4N4O5S and a molecular weight of 624.66 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-4-oxo-5-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-4-oxo-5-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 164874512 |
| Molecular Formula | C29H32F4N4O5S |
| Molecular Weight | 624.66 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | tert-butyl N-[(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-4-oxo-5-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CSc2ccc(-c3nnc(C(C)(C)C)o3)cc2N(Cc2ccc(OC(F)(F)C(F)F)cc2)C1=O |
| InChI | InChI=1S/C29H32F4N4O5S/c1-27(2,3)25-36-35-22(40-25)17-9-12-21-20(13-17)37(23(38)19(15-43-21)34-26(39)42-28(4,5)6)14-16-7-10-18(11-8-16)41-29(32,33)24(30)31/h7-13,19,24H,14-15H2,1-6H3,(H,34,39)/t19-/m0/s1 |
| InChIKey | HMIJAHUHMXODKH-IBGZPJMESA-N |
| XLogP | 6.80 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.66 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|