C23H25F3N4O5S — CID 164874041
tert-butyl N-[(3R)-7-(hydrazinecarbonyl)-4-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate (PubChem CID 164874041) has the molecular formula C23H25F3N4O5S and a molecular weight of 526.54 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-(hydrazinecarbonyl)-4-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-7-(hydrazinecarbonyl)-4-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 164874041 |
| Molecular Formula | C23H25F3N4O5S |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | tert-butyl N-[(3R)-7-(hydrazinecarbonyl)-4-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CSc2ccc(C(=O)NN)cc2N(Cc2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C23H25F3N4O5S/c1-22(2,3)35-21(33)28-16-12-36-18-9-6-14(19(31)29-27)10-17(18)30(20(16)32)11-13-4-7-15(8-5-13)34-23(24,25)26/h4-10,16H,11-12,27H2,1-3H3,(H,28,33)(H,29,31)/t16-/m0/s1 |
| InChIKey | BHJKMSPCUWCWAF-INIZCTEOSA-N |
| XLogP | 3.72 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|