C30H41N3O4S — CID 134608981
tert-butyl N-[(3R)-7-(butylcarbamoyl)-5-[(4-tert-butylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate (PubChem CID 134608981) has the molecular formula C30H41N3O4S and a molecular weight of 539.74 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-(butylcarbamoyl)-5-[(4-tert-butylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-7-(butylcarbamoyl)-5-[(4-tert-butylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 134608981 |
| Molecular Formula | C30H41N3O4S |
| Molecular Weight | 539.74 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | tert-butyl N-[(3R)-7-(butylcarbamoyl)-5-[(4-tert-butylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
| SMILES | CCCCNC(=O)c1ccc2c(c1)N(Cc1ccc(C(C)(C)C)cc1)C(=O)[C@@H](NC(=O)OC(C)(C)C)CS2 |
| InChI | InChI=1S/C30H41N3O4S/c1-8-9-16-31-26(34)21-12-15-25-24(17-21)33(18-20-10-13-22(14-11-20)29(2,3)4)27(35)23(19-38-25)32-28(36)37-30(5,6)7/h10-15,17,23H,8-9,16,18-19H2,1-7H3,(H,31,34)(H,32,36)/t23-/m0/s1 |
| InChIKey | DYNMINVSUAIJPC-QHCPKHFHSA-N |
| XLogP | 6.05 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|