C26H31ClN2O5S — CID 162073750
tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-4-oxo-7-(2-propoxyacetyl)-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate (PubChem CID 162073750) has the molecular formula C26H31ClN2O5S and a molecular weight of 519.06 g/mol. Its IUPAC name is tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-4-oxo-7-(2-propoxyacetyl)-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-4-oxo-7-(2-propoxyacetyl)-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 162073750 |
| Molecular Formula | C26H31ClN2O5S |
| Molecular Weight | 519.06 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | tert-butyl N-[(3R)-5-[(4-chlorophenyl)methyl]-4-oxo-7-(2-propoxyacetyl)-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
| SMILES | CCCOCC(=O)c1ccc2c(c1)N(Cc1ccc(Cl)cc1)C(=O)[C@@H](NC(=O)OC(C)(C)C)CS2 |
| InChI | InChI=1S/C26H31ClN2O5S/c1-5-12-33-15-22(30)18-8-11-23-21(13-18)29(14-17-6-9-19(27)10-7-17)24(31)20(16-35-23)28-25(32)34-26(2,3)4/h6-11,13,20H,5,12,14-16H2,1-4H3,(H,28,32)/t20-/m0/s1 |
| InChIKey | ZBKZNCPSJGXRBO-FQEVSTJZSA-N |
| XLogP | 5.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.06 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|