C30H40N4O5S — CID 134608826
tert-butyl N-[(3R)-7-(butylcarbamoyl)-5-[(4-morpholin-4-ylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate (PubChem CID 134608826) has the molecular formula C30H40N4O5S and a molecular weight of 568.74 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-(butylcarbamoyl)-5-[(4-morpholin-4-ylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-7-(butylcarbamoyl)-5-[(4-morpholin-4-ylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 134608826 |
| Molecular Formula | C30H40N4O5S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | tert-butyl N-[(3R)-7-(butylcarbamoyl)-5-[(4-morpholin-4-ylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]carbamate |
| SMILES | CCCCNC(=O)c1ccc2c(c1)N(Cc1ccc(N3CCOCC3)cc1)C(=O)[C@@H](NC(=O)OC(C)(C)C)CS2 |
| InChI | InChI=1S/C30H40N4O5S/c1-5-6-13-31-27(35)22-9-12-26-25(18-22)34(28(36)24(20-40-26)32-29(37)39-30(2,3)4)19-21-7-10-23(11-8-21)33-14-16-38-17-15-33/h7-12,18,24H,5-6,13-17,19-20H2,1-4H3,(H,31,35)(H,32,37)/t24-/m0/s1 |
| InChIKey | QENGORGSNUTPAF-DEOSSOPVSA-N |
| XLogP | 4.59 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|