C23H29N3O2S — CID 145147823
(3R)-N-butyl-3-(methylamino)-5-[(4-methylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepine-7-carboxamide (PubChem CID 145147823) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is (3R)-N-butyl-3-(methylamino)-5-[(4-methylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepine-7-carboxamide.
| Compound Name | (3R)-N-butyl-3-(methylamino)-5-[(4-methylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 145147823 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (3R)-N-butyl-3-(methylamino)-5-[(4-methylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzothiazepine-7-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(c1)N(Cc1ccc(C)cc1)C(=O)[C@@H](NC)CS2 |
| InChI | InChI=1S/C23H29N3O2S/c1-4-5-12-25-22(27)18-10-11-21-20(13-18)26(23(28)19(24-3)15-29-21)14-17-8-6-16(2)7-9-17/h6-11,13,19,24H,4-5,12,14-15H2,1-3H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | KGXPCLQIOHZCDE-IBGZPJMESA-N |
| XLogP | 3.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|