C23H23F4N5O4S — CID 172879045
(1S,3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1-imino-1-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 172879045) has the molecular formula C23H23F4N5O4S and a molecular weight of 541.53 g/mol. Its IUPAC name is (1S,3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1-imino-1-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (1S,3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1-imino-1-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 172879045 |
| Molecular Formula | C23H23F4N5O4S |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | (1S,3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1-imino-1-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | [H]N=[S@]1(=O)C[C@H](N)C(=O)N(Cc2ccc(OC(F)(F)F)cc2)c2cc(-c3nnc(C(C)(C)C)o3)c(F)cc21 |
| InChI | InChI=1S/C23H23F4N5O4S/c1-22(2,3)21-31-30-19(35-21)14-8-17-18(9-15(14)24)37(29,34)11-16(28)20(33)32(17)10-12-4-6-13(7-5-12)36-23(25,26)27/h4-9,16,29H,10-11,28H2,1-3H3/t16-,37-/m0/s1 |
| InChIKey | CIUYKJFWLABQJG-WBEMDPPOSA-N |
| XLogP | 4.35 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |