C23H22FN5O4S — CID 169274330
4-[[(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]methyl]benzonitrile (PubChem CID 169274330) has the molecular formula C23H22FN5O4S and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-[[(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]methyl]benzonitrile.
| Compound Name | 4-[[(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 169274330 |
| Molecular Formula | C23H22FN5O4S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 4-[[(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]methyl]benzonitrile |
| SMILES | CC(C)(C)c1nnc(-c2cc3c(cc2F)S(=O)(=O)C[C@H](N)C(=O)N3Cc2ccc(C#N)cc2)o1 |
| InChI | InChI=1S/C23H22FN5O4S/c1-23(2,3)22-28-27-20(33-22)15-8-18-19(9-16(15)24)34(31,32)12-17(26)21(30)29(18)11-14-6-4-13(10-25)5-7-14/h4-9,17H,11-12,26H2,1-3H3/t17-/m0/s1 |
| InChIKey | TXLQBLZNXYCNIS-KRWDZBQOSA-N |
| XLogP | 2.69 |
| TPSA | 143.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |