C26H29N5O4S — CID 171573549
2-[4-[[(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]methyl]phenyl]-2-methylpropanenitrile (PubChem CID 171573549) has the molecular formula C26H29N5O4S and a molecular weight of 507.62 g/mol. Its IUPAC name is 2-[4-[[(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]methyl]phenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[[(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]methyl]phenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 171573549 |
| Molecular Formula | C26H29N5O4S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[4-[[(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]methyl]phenyl]-2-methylpropanenitrile |
| SMILES | CC(C)(C)c1nnc(-c2ccc3c(c2)N(Cc2ccc(C(C)(C)C#N)cc2)C(=O)[C@@H](N)CS3(=O)=O)o1 |
| InChI | InChI=1S/C26H29N5O4S/c1-25(2,3)24-30-29-22(35-24)17-8-11-21-20(12-17)31(23(32)19(28)14-36(21,33)34)13-16-6-9-18(10-7-16)26(4,5)15-27/h6-12,19H,13-14,28H2,1-5H3/t19-/m0/s1 |
| InChIKey | IQMLIPKVJAPORX-IBGZPJMESA-N |
| XLogP | 3.48 |
| TPSA | 143.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |