C21H14F8N4O5S — CID 171573634
(3R)-3-amino-1,1-dioxo-7-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazol-2-yl]-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 171573634) has the molecular formula C21H14F8N4O5S and a molecular weight of 586.42 g/mol. Its IUPAC name is (3R)-3-amino-1,1-dioxo-7-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazol-2-yl]-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-1,1-dioxo-7-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazol-2-yl]-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 171573634 |
| Molecular Formula | C21H14F8N4O5S |
| Molecular Weight | 586.42 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | (3R)-3-amino-1,1-dioxo-7-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazol-2-yl]-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | N[C@H]1CS(=O)(=O)c2ccc(-c3nnc(C(F)(F)C(F)(F)F)o3)cc2N(Cc2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C21H14F8N4O5S/c22-19(23,20(24,25)26)18-32-31-16(37-18)11-3-6-15-14(7-11)33(17(34)13(30)9-39(15,35)36)8-10-1-4-12(5-2-10)38-21(27,28)29/h1-7,13H,8-9,30H2/t13-/m0/s1 |
| InChIKey | PSKRAYATMGBGIM-ZDUSSCGKSA-N |
| XLogP | 3.94 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|