C28H27ClN4O7S2 — CID 176890902
(3R)-3-amino-5-[[4-(3-chlorophenoxy)phenyl]methyl]-7-[5-(2-methylsulfonylpropan-2-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 176890902) has the molecular formula C28H27ClN4O7S2 and a molecular weight of 631.13 g/mol. Its IUPAC name is (3R)-3-amino-5-[[4-(3-chlorophenoxy)phenyl]methyl]-7-[5-(2-methylsulfonylpropan-2-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-5-[[4-(3-chlorophenoxy)phenyl]methyl]-7-[5-(2-methylsulfonylpropan-2-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 176890902 |
| Molecular Formula | C28H27ClN4O7S2 |
| Molecular Weight | 631.13 g/mol |
| Exact Mass | 630.10 |
| IUPAC Name | (3R)-3-amino-5-[[4-(3-chlorophenoxy)phenyl]methyl]-7-[5-(2-methylsulfonylpropan-2-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | CC(C)(c1nnc(-c2ccc3c(c2)N(Cc2ccc(Oc4cccc(Cl)c4)cc2)C(=O)[C@@H](N)CS3(=O)=O)o1)S(C)(=O)=O |
| InChI | InChI=1S/C28H27ClN4O7S2/c1-28(2,41(3,35)36)27-32-31-25(40-27)18-9-12-24-23(13-18)33(26(34)22(30)16-42(24,37)38)15-17-7-10-20(11-8-17)39-21-6-4-5-19(29)14-21/h4-14,22H,15-16,30H2,1-3H3/t22-/m0/s1 |
| InChIKey | JBYYCFHTPDEEEW-QFIPXVFZSA-N |
| XLogP | 4.11 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.13 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |