C24H25F3N4O5S — CID 164874114
(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1-dioxo-5-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 164874114) has the molecular formula C24H25F3N4O5S and a molecular weight of 538.55 g/mol. Its IUPAC name is (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1-dioxo-5-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1-dioxo-5-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 164874114 |
| Molecular Formula | C24H25F3N4O5S |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-1,1-dioxo-5-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | CC(C)(C)c1nnc(-c2ccc3c(c2)N(Cc2ccc(OCC(F)(F)F)cc2)C(=O)[C@@H](N)CS3(=O)=O)o1 |
| InChI | InChI=1S/C24H25F3N4O5S/c1-23(2,3)22-30-29-20(36-22)15-6-9-19-18(10-15)31(21(32)17(28)12-37(19,33)34)11-14-4-7-16(8-5-14)35-13-24(25,26)27/h4-10,17H,11-13,28H2,1-3H3/t17-/m0/s1 |
| InChIKey | HFOLZVPJPDYAJQ-KRWDZBQOSA-N |
| XLogP | 3.62 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |