C22H24FN5O5S — CID 169274350
(3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-5-[(6-methoxy-3-pyridinyl)methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 169274350) has the molecular formula C22H24FN5O5S and a molecular weight of 489.53 g/mol. Its IUPAC name is (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-5-[(6-methoxy-3-pyridinyl)methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-5-[(6-methoxy-3-pyridinyl)methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 169274350 |
| Molecular Formula | C22H24FN5O5S |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | (3R)-3-amino-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-8-fluoro-5-[(6-methoxy-3-pyridinyl)methyl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | COc1ccc(CN2C(=O)[C@@H](N)CS(=O)(=O)c3cc(F)c(-c4nnc(C(C)(C)C)o4)cc32)cn1 |
| InChI | InChI=1S/C22H24FN5O5S/c1-22(2,3)21-27-26-19(33-21)13-7-16-17(8-14(13)23)34(30,31)11-15(24)20(29)28(16)10-12-5-6-18(32-4)25-9-12/h5-9,15H,10-11,24H2,1-4H3/t15-/m0/s1 |
| InChIKey | SWFWHXKWVXJTKW-HNNXBMFYSA-N |
| XLogP | 2.22 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |