C24H25ClFN5O4S — CID 171774076
(3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(cyclohexylamino)-1,3,4-oxadiazol-2-yl]-8-fluoro-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 171774076) has the molecular formula C24H25ClFN5O4S and a molecular weight of 534.01 g/mol. Its IUPAC name is (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(cyclohexylamino)-1,3,4-oxadiazol-2-yl]-8-fluoro-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(cyclohexylamino)-1,3,4-oxadiazol-2-yl]-8-fluoro-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 171774076 |
| Molecular Formula | C24H25ClFN5O4S |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(cyclohexylamino)-1,3,4-oxadiazol-2-yl]-8-fluoro-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | N[C@H]1CS(=O)(=O)c2cc(F)c(-c3nnc(NC4CCCCC4)o3)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H25ClFN5O4S/c25-15-8-6-14(7-9-15)12-31-20-10-17(18(26)11-21(20)36(33,34)13-19(27)23(31)32)22-29-30-24(35-22)28-16-4-2-1-3-5-16/h6-11,16,19H,1-5,12-13,27H2,(H,28,30)/t19-/m0/s1 |
| InChIKey | AIKIXSXYDLKAEZ-IBGZPJMESA-N |
| XLogP | 3.92 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |