C24H25ClFN5O4S — CID 169274362
(3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(3-fluoro-1-methylpiperidin-3-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 169274362) has the molecular formula C24H25ClFN5O4S and a molecular weight of 534.01 g/mol. Its IUPAC name is (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(3-fluoro-1-methylpiperidin-3-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(3-fluoro-1-methylpiperidin-3-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 169274362 |
| Molecular Formula | C24H25ClFN5O4S |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | (3R)-3-amino-5-[(4-chlorophenyl)methyl]-7-[5-(3-fluoro-1-methylpiperidin-3-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | CN1CCCC(F)(c2nnc(-c3ccc4c(c3)N(Cc3ccc(Cl)cc3)C(=O)[C@@H](N)CS4(=O)=O)o2)C1 |
| InChI | InChI=1S/C24H25ClFN5O4S/c1-30-10-2-9-24(26,14-30)23-29-28-21(35-23)16-5-8-20-19(11-16)31(12-15-3-6-17(25)7-4-15)22(32)18(27)13-36(20,33)34/h3-8,11,18H,2,9-10,12-14,27H2,1H3/t18-,24?/m0/s1 |
| InChIKey | VEYIGDMPZHGJSJ-VEXWJQHLSA-N |
| XLogP | 2.93 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |