C23H23ClFN5O5S — CID 171573595
5-[(3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-7-yl]-N-tert-butyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 171573595) has the molecular formula C23H23ClFN5O5S and a molecular weight of 535.99 g/mol. Its IUPAC name is 5-[(3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-7-yl]-N-tert-butyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-[(3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-7-yl]-N-tert-butyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 171573595 |
| Molecular Formula | C23H23ClFN5O5S |
| Molecular Weight | 535.99 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 5-[(3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-7-yl]-N-tert-butyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1nnc(-c2cc3c(cc2F)S(=O)(=O)C[C@H](N)C(=O)N3Cc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C23H23ClFN5O5S/c1-23(2,3)27-19(31)21-29-28-20(35-21)14-8-17-18(9-15(14)25)36(33,34)11-16(26)22(32)30(17)10-12-4-6-13(24)7-5-12/h4-9,16H,10-11,26H2,1-3H3,(H,27,31)/t16-/m0/s1 |
| InChIKey | XWEWBPAUEKZLNS-INIZCTEOSA-N |
| XLogP | 2.71 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.99 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |