C26H29F2N3O7S — CID 134609255
tert-butyl N-[(3R)-7-[[(1R)-2,2-difluorocyclopropyl]carbamoyl]-5-[(4-methoxyphenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate (PubChem CID 134609255) has the molecular formula C26H29F2N3O7S and a molecular weight of 565.60 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-[[(1R)-2,2-difluorocyclopropyl]carbamoyl]-5-[(4-methoxyphenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-7-[[(1R)-2,2-difluorocyclopropyl]carbamoyl]-5-[(4-methoxyphenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 134609255 |
| Molecular Formula | C26H29F2N3O7S |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | tert-butyl N-[(3R)-7-[[(1R)-2,2-difluorocyclopropyl]carbamoyl]-5-[(4-methoxyphenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
| SMILES | COc1ccc(CN2C(=O)[C@@H](NC(=O)OC(C)(C)C)CS(=O)(=O)c3ccc(C(=O)N[C@@H]4CC4(F)F)cc32)cc1 |
| InChI | InChI=1S/C26H29F2N3O7S/c1-25(2,3)38-24(34)29-18-14-39(35,36)20-10-7-16(22(32)30-21-12-26(21,27)28)11-19(20)31(23(18)33)13-15-5-8-17(37-4)9-6-15/h5-11,18,21H,12-14H2,1-4H3,(H,29,34)(H,30,32)/t18-,21+/m0/s1 |
| InChIKey | LLUACABLWTWCHL-GHTZIAJQSA-N |
| XLogP | 3.05 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |