C26H30ClN3O6S — CID 134609324
tert-butyl N-[(3R)-7-(but-3-enylcarbamoyl)-5-[(4-chlorophenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate (PubChem CID 134609324) has the molecular formula C26H30ClN3O6S and a molecular weight of 548.06 g/mol. Its IUPAC name is tert-butyl N-[(3R)-7-(but-3-enylcarbamoyl)-5-[(4-chlorophenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-7-(but-3-enylcarbamoyl)-5-[(4-chlorophenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 134609324 |
| Molecular Formula | C26H30ClN3O6S |
| Molecular Weight | 548.06 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | tert-butyl N-[(3R)-7-(but-3-enylcarbamoyl)-5-[(4-chlorophenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
| SMILES | C=CCCNC(=O)c1ccc2c(c1)N(Cc1ccc(Cl)cc1)C(=O)[C@@H](NC(=O)OC(C)(C)C)CS2(=O)=O |
| InChI | InChI=1S/C26H30ClN3O6S/c1-5-6-13-28-23(31)18-9-12-22-21(14-18)30(15-17-7-10-19(27)11-8-17)24(32)20(16-37(22,34)35)29-25(33)36-26(2,3)4/h5,7-12,14,20H,1,6,13,15-16H2,2-4H3,(H,28,31)(H,29,33)/t20-/m0/s1 |
| InChIKey | IVOVBYILSPXVTE-FQEVSTJZSA-N |
| XLogP | 3.86 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.06 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|