C26H28Cl2F3N3O6S — CID 134609149
tert-butyl N-[(3R)-8-chloro-5-[(4-chlorophenyl)methyl]-1,1,4-trioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate (PubChem CID 134609149) has the molecular formula C26H28Cl2F3N3O6S and a molecular weight of 638.49 g/mol. Its IUPAC name is tert-butyl N-[(3R)-8-chloro-5-[(4-chlorophenyl)methyl]-1,1,4-trioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-8-chloro-5-[(4-chlorophenyl)methyl]-1,1,4-trioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 134609149 |
| Molecular Formula | C26H28Cl2F3N3O6S |
| Molecular Weight | 638.49 g/mol |
| Exact Mass | 637.10 |
| IUPAC Name | tert-butyl N-[(3R)-8-chloro-5-[(4-chlorophenyl)methyl]-1,1,4-trioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CS(=O)(=O)c2cc(Cl)c(C(=O)NCCCC(F)(F)F)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C26H28Cl2F3N3O6S/c1-25(2,3)40-24(37)33-19-14-41(38,39)21-12-18(28)17(22(35)32-10-4-9-26(29,30)31)11-20(21)34(23(19)36)13-15-5-7-16(27)8-6-15/h5-8,11-12,19H,4,9-10,13-14H2,1-3H3,(H,32,35)(H,33,37)/t19-/m0/s1 |
| InChIKey | ILJJZXAZUHLVMK-IBGZPJMESA-N |
| XLogP | 5.28 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|