C22H23Cl2F4N3O4S — CID 134609076
(2R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-2-methyl-1,1,4-trioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide;hydrochloride (PubChem CID 134609076) has the molecular formula C22H23Cl2F4N3O4S and a molecular weight of 572.41 g/mol. Its IUPAC name is (2R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-2-methyl-1,1,4-trioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide;hydrochloride.
| Compound Name | (2R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-2-methyl-1,1,4-trioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 134609076 |
| Molecular Formula | C22H23Cl2F4N3O4S |
| Molecular Weight | 572.41 g/mol |
| Exact Mass | 571.07 |
| IUPAC Name | (2R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-2-methyl-1,1,4-trioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide;hydrochloride |
| SMILES | C[C@@H]1[C@H](N)C(=O)N(Cc2ccc(Cl)cc2)c2cc(C(=O)NCCCC(F)(F)F)c(F)cc2S1(=O)=O.Cl |
| InChI | InChI=1S/C22H22ClF4N3O4S.ClH/c1-12-19(28)21(32)30(11-13-3-5-14(23)6-4-13)17-9-15(16(24)10-18(17)35(12,33)34)20(31)29-8-2-7-22(25,26)27;/h3-6,9-10,12,19H,2,7-8,11,28H2,1H3,(H,29,31);1H/t12-,19+;/m1./s1 |
| InChIKey | OOTDZTQIZMQJNE-LHTCIHGGSA-N |
| XLogP | 4.01 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|