C26H30ClF4N3O4S — CID 163944078
(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-N-[(2-methylpropan-2-yl)oxymethyl]-4-oxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1,5-benzothiazepin-3-amine oxide (PubChem CID 163944078) has the molecular formula C26H30ClF4N3O4S and a molecular weight of 592.06 g/mol. Its IUPAC name is (3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-N-[(2-methylpropan-2-yl)oxymethyl]-4-oxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1,5-benzothiazepin-3-amine oxide.
| Compound Name | (3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-N-[(2-methylpropan-2-yl)oxymethyl]-4-oxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1,5-benzothiazepin-3-amine oxide |
|---|---|
| PubChem CID | 163944078 |
| Molecular Formula | C26H30ClF4N3O4S |
| Molecular Weight | 592.06 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | (3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-N-[(2-methylpropan-2-yl)oxymethyl]-4-oxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1,5-benzothiazepin-3-amine oxide |
| SMILES | CC(C)(C)OC[NH+]([O-])[C@H]1CSc2cc(F)c(C(=O)NCCCC(F)(F)F)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C26H30ClF4N3O4S/c1-25(2,3)38-15-34(37)21-14-39-22-12-19(28)18(23(35)32-10-4-9-26(29,30)31)11-20(22)33(24(21)36)13-16-5-7-17(27)8-6-16/h5-8,11-12,21,34H,4,9-10,13-15H2,1-3H3,(H,32,35)/t21-/m0/s1 |
| InChIKey | RTOMJNZIDTTXDQ-NRFANRHFSA-N |
| XLogP | 4.71 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.06 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|