C21H20ClF4N3O3S — CID 134609010
(1R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,4-dioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ4,5-benzothiazepine-7-carboxamide (PubChem CID 134609010) has the molecular formula C21H20ClF4N3O3S and a molecular weight of 505.92 g/mol. Its IUPAC name is (1R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,4-dioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ4,5-benzothiazepine-7-carboxamide.
| Compound Name | (1R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,4-dioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ4,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 134609010 |
| Molecular Formula | C21H20ClF4N3O3S |
| Molecular Weight | 505.92 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | (1R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,4-dioxo-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1λ4,5-benzothiazepine-7-carboxamide |
| SMILES | N[C@H]1C[S@@](=O)c2cc(F)c(C(=O)NCCCC(F)(F)F)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C21H20ClF4N3O3S/c22-13-4-2-12(3-5-13)10-29-17-8-14(19(30)28-7-1-6-21(24,25)26)15(23)9-18(17)33(32)11-16(27)20(29)31/h2-5,8-9,16H,1,6-7,10-11,27H2,(H,28,30)/t16-,33+/m0/s1 |
| InChIKey | YXJRBDPFDTWYOP-AESQFQPQSA-N |
| XLogP | 3.53 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.92 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|