C26H28ClF4N3O5S — CID 134609294
tert-butyl N-[(1S,3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-1,4-dioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ4,5-benzothiazepin-3-yl]carbamate (PubChem CID 134609294) has the molecular formula C26H28ClF4N3O5S and a molecular weight of 606.04 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-1,4-dioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ4,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-1,4-dioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ4,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 134609294 |
| Molecular Formula | C26H28ClF4N3O5S |
| Molecular Weight | 606.04 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | tert-butyl N-[(1S,3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-1,4-dioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ4,5-benzothiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[S@](=O)c2cc(F)c(C(=O)NCCCC(F)(F)F)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C26H28ClF4N3O5S/c1-25(2,3)39-24(37)33-19-14-40(38)21-12-18(28)17(22(35)32-10-4-9-26(29,30)31)11-20(21)34(23(19)36)13-15-5-7-16(27)8-6-15/h5-8,11-12,19H,4,9-10,13-14H2,1-3H3,(H,32,35)(H,33,37)/t19-,40-/m0/s1 |
| InChIKey | CYOIJWUMAAUYRN-TYNIYAAZSA-N |
| XLogP | 5.10 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.04 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|