C30H31ClFN3O5S — CID 135139813
(3R)-N-benzyl-5-[(4-chlorophenyl)methyl]-3-(3,3-dimethylbutanoylamino)-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide (PubChem CID 135139813) has the molecular formula C30H31ClFN3O5S and a molecular weight of 600.11 g/mol. Its IUPAC name is (3R)-N-benzyl-5-[(4-chlorophenyl)methyl]-3-(3,3-dimethylbutanoylamino)-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide.
| Compound Name | (3R)-N-benzyl-5-[(4-chlorophenyl)methyl]-3-(3,3-dimethylbutanoylamino)-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 135139813 |
| Molecular Formula | C30H31ClFN3O5S |
| Molecular Weight | 600.11 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | (3R)-N-benzyl-5-[(4-chlorophenyl)methyl]-3-(3,3-dimethylbutanoylamino)-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide |
| SMILES | CC(C)(C)CC(=O)N[C@H]1CS(=O)(=O)c2cc(F)c(C(=O)NCc3ccccc3)cc2N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C30H31ClFN3O5S/c1-30(2,3)15-27(36)34-24-18-41(39,40)26-14-23(32)22(28(37)33-16-19-7-5-4-6-8-19)13-25(26)35(29(24)38)17-20-9-11-21(31)12-10-20/h4-14,24H,15-18H2,1-3H3,(H,33,37)(H,34,36)/t24-/m0/s1 |
| InChIKey | IBKBDCVCHGFNBK-DEOSSOPVSA-N |
| XLogP | 4.65 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.11 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |