C23H24ClF3N2O4S — CID 158274693
(2R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-2-methyl-1,1-dioxo-7-(6,6,6-trifluorohexanoyl)-2,3-dihydro-1λ6,5-benzothiazepin-4-one (PubChem CID 158274693) has the molecular formula C23H24ClF3N2O4S and a molecular weight of 516.97 g/mol. Its IUPAC name is (2R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-2-methyl-1,1-dioxo-7-(6,6,6-trifluorohexanoyl)-2,3-dihydro-1λ6,5-benzothiazepin-4-one.
| Compound Name | (2R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-2-methyl-1,1-dioxo-7-(6,6,6-trifluorohexanoyl)-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 158274693 |
| Molecular Formula | C23H24ClF3N2O4S |
| Molecular Weight | 516.97 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | (2R,3R)-3-amino-5-[(4-chlorophenyl)methyl]-2-methyl-1,1-dioxo-7-(6,6,6-trifluorohexanoyl)-2,3-dihydro-1λ6,5-benzothiazepin-4-one |
| SMILES | C[C@@H]1[C@H](N)C(=O)N(Cc2ccc(Cl)cc2)c2cc(C(=O)CCCCC(F)(F)F)ccc2S1(=O)=O |
| InChI | InChI=1S/C23H24ClF3N2O4S/c1-14-21(28)22(31)29(13-15-5-8-17(24)9-6-15)18-12-16(7-10-20(18)34(14,32)33)19(30)4-2-3-11-23(25,26)27/h5-10,12,14,21H,2-4,11,13,28H2,1H3/t14-,21+/m1/s1 |
| InChIKey | GJLQXFYDZDYHFE-SZNDQCEHSA-N |
| XLogP | 4.68 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.97 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|