C13H15NO4S — CID 84615918
6-acetyl-4-ethyl-2-methyl-1,1-dioxo-1λ6,4-benzothiazin-3-one (PubChem CID 84615918) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 6-acetyl-4-ethyl-2-methyl-1,1-dioxo-1λ6,4-benzothiazin-3-one.
| Compound Name | 6-acetyl-4-ethyl-2-methyl-1,1-dioxo-1λ6,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84615918 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 6-acetyl-4-ethyl-2-methyl-1,1-dioxo-1λ6,4-benzothiazin-3-one |
| SMILES | CCN1C(=O)C(C)S(=O)(=O)c2ccc(C(C)=O)cc21 |
| InChI | InChI=1S/C13H15NO4S/c1-4-14-11-7-10(8(2)15)5-6-12(11)19(17,18)9(3)13(14)16/h5-7,9H,4H2,1-3H3 |
| InChIKey | WASQVZABIFMRFA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |