C29H32F3N5O7S — CID 134609197
tert-butyl N-[(3R)-5-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-1,1,4-trioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate (PubChem CID 134609197) has the molecular formula C29H32F3N5O7S and a molecular weight of 651.66 g/mol. Its IUPAC name is tert-butyl N-[(3R)-5-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-1,1,4-trioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-5-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-1,1,4-trioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 134609197 |
| Molecular Formula | C29H32F3N5O7S |
| Molecular Weight | 651.66 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | tert-butyl N-[(3R)-5-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-1,1,4-trioxo-7-(4,4,4-trifluorobutylcarbamoyl)-2,3-dihydro-1λ6,5-benzothiazepin-3-yl]carbamate |
| SMILES | Cc1nc(-c2ccc(CN3C(=O)[C@@H](NC(=O)OC(C)(C)C)CS(=O)(=O)c4ccc(C(=O)NCCCC(F)(F)F)cc43)cc2)no1 |
| InChI | InChI=1S/C29H32F3N5O7S/c1-17-34-24(36-44-17)19-8-6-18(7-9-19)15-37-22-14-20(25(38)33-13-5-12-29(30,31)32)10-11-23(22)45(41,42)16-21(26(37)39)35-27(40)43-28(2,3)4/h6-11,14,21H,5,12-13,15-16H2,1-4H3,(H,33,38)(H,35,40)/t21-/m0/s1 |
| InChIKey | YVSJCCGNCCSAIR-NRFANRHFSA-N |
| XLogP | 4.33 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|