C24H27F2N3O5S — CID 134609179
(3R)-3-amino-N-(4,4-difluorocyclohexyl)-5-[(4-methoxyphenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide (PubChem CID 134609179) has the molecular formula C24H27F2N3O5S and a molecular weight of 507.56 g/mol. Its IUPAC name is (3R)-3-amino-N-(4,4-difluorocyclohexyl)-5-[(4-methoxyphenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide.
| Compound Name | (3R)-3-amino-N-(4,4-difluorocyclohexyl)-5-[(4-methoxyphenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 134609179 |
| Molecular Formula | C24H27F2N3O5S |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (3R)-3-amino-N-(4,4-difluorocyclohexyl)-5-[(4-methoxyphenyl)methyl]-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepine-7-carboxamide |
| SMILES | COc1ccc(CN2C(=O)[C@@H](N)CS(=O)(=O)c3ccc(C(=O)NC4CCC(F)(F)CC4)cc32)cc1 |
| InChI | InChI=1S/C24H27F2N3O5S/c1-34-18-5-2-15(3-6-18)13-29-20-12-16(22(30)28-17-8-10-24(25,26)11-9-17)4-7-21(20)35(32,33)14-19(27)23(29)31/h2-7,12,17,19H,8-11,13-14,27H2,1H3,(H,28,30)/t19-/m0/s1 |
| InChIKey | MAMFKLJDZWEWDG-IBGZPJMESA-N |
| XLogP | 2.65 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |