C26H25ClN4O4 — CID 148710138
methyl 4-(2-chlorophenyl)-6-[3-hydroxy-3-(4-hydroxyanilino)propyl]-2-pyridin-2-yl-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 148710138) has the molecular formula C26H25ClN4O4 and a molecular weight of 492.96 g/mol. Its IUPAC name is methyl 4-(2-chlorophenyl)-6-[3-hydroxy-3-(4-hydroxyanilino)propyl]-2-pyridin-2-yl-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 4-(2-chlorophenyl)-6-[3-hydroxy-3-(4-hydroxyanilino)propyl]-2-pyridin-2-yl-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 148710138 |
| Molecular Formula | C26H25ClN4O4 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | methyl 4-(2-chlorophenyl)-6-[3-hydroxy-3-(4-hydroxyanilino)propyl]-2-pyridin-2-yl-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(CCC(O)Nc2ccc(O)cc2)NC(c2ccccn2)=NC1c1ccccc1Cl |
| InChI | InChI=1S/C26H25ClN4O4/c1-35-26(34)23-20(13-14-22(33)29-16-9-11-17(32)12-10-16)30-25(21-8-4-5-15-28-21)31-24(23)18-6-2-3-7-19(18)27/h2-12,15,22,24,29,32-33H,13-14H2,1H3,(H,30,31) |
| InChIKey | NXBNANZFXBTQRA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|