C21H18ClFN4O2 — CID 71494454
methyl 4-(2-chloro-4-fluorophenyl)-6-[(prop-2-ynylamino)methyl]-2-pyridin-2-yl-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 71494454) has the molecular formula C21H18ClFN4O2 and a molecular weight of 412.85 g/mol. Its IUPAC name is methyl 4-(2-chloro-4-fluorophenyl)-6-[(prop-2-ynylamino)methyl]-2-pyridin-2-yl-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 4-(2-chloro-4-fluorophenyl)-6-[(prop-2-ynylamino)methyl]-2-pyridin-2-yl-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 71494454 |
| Molecular Formula | C21H18ClFN4O2 |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | methyl 4-(2-chloro-4-fluorophenyl)-6-[(prop-2-ynylamino)methyl]-2-pyridin-2-yl-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | C#CCNCC1=C(C(=O)OC)C(c2ccc(F)cc2Cl)N=C(c2ccccn2)N1 |
| InChI | InChI=1S/C21H18ClFN4O2/c1-3-9-24-12-17-18(21(28)29-2)19(14-8-7-13(23)11-15(14)22)27-20(26-17)16-6-4-5-10-25-16/h1,4-8,10-11,19,24H,9,12H2,2H3,(H,26,27) |
| InChIKey | RCMOGFUMWNDDEB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|