C14H18O2S — CID 14871522
S-ethyl (E,2S,3R)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate (PubChem CID 14871522) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is S-ethyl (E,2S,3R)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate.
| Compound Name | S-ethyl (E,2S,3R)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate |
|---|---|
| PubChem CID | 14871522 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | S-ethyl (E,2S,3R)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate |
| SMILES | CCSC(=O)[C@@H](C)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H18O2S/c1-3-17-14(16)11(2)13(15)10-9-12-7-5-4-6-8-12/h4-11,13,15H,3H2,1-2H3/b10-9+/t11-,13+/m0/s1 |
| InChIKey | JOBKQDXFXLZNPW-IMYBMRPDSA-N |
| XLogP | 2.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|