C16H22O2S — CID 10978793
S-tert-butyl (E,2S,3S)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate (PubChem CID 10978793) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is S-tert-butyl (E,2S,3S)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate.
| Compound Name | S-tert-butyl (E,2S,3S)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate |
|---|---|
| PubChem CID | 10978793 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | S-tert-butyl (E,2S,3S)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate |
| SMILES | C[C@H](C(=O)SC(C)(C)C)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H22O2S/c1-12(15(18)19-16(2,3)4)14(17)11-10-13-8-6-5-7-9-13/h5-12,14,17H,1-4H3/b11-10+/t12-,14-/m0/s1 |
| InChIKey | PIZSXQFDKPYHBF-IWYIRLTCSA-N |
| XLogP | 3.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|