C28H36F2N8O2Si- — CID 148718609
CID 148718609 (PubChem CID 148718609) has the molecular formula C28H36F2N8O2Si- and a molecular weight of 582.73 g/mol.
| Compound Name | CID 148718609 |
|---|---|
| PubChem CID | 148718609 |
| Molecular Formula | C28H36F2N8O2Si- |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1cc(Nc2nccc(-c3cc(C#N)c4c(c3)[C@@](C)(CO[Si-](C)(C)C(C)(C)C)CN4)n2)nn1CC(F)F |
| InChI | InChI=1S/C28H36F2N8O2Si/c1-27(2,3)41(6,7)40-16-28(4)15-34-24-18(13-31)10-17(11-19(24)28)20-8-9-33-26(35-20)36-23-12-21(25(39)32-5)38(37-23)14-22(29)30/h8-12,22,34H,14-16H2,1-7H3,(H,32,39)(H,33,35,36,37)/q-1/t28-/m1/s1 |
| InChIKey | SASJOLISRDTRDQ-MUUNZHRXSA-N |
| XLogP | 5.29 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|