C18H21Cl2NO — CID 1487207
2-[[(2R)-butan-2-yl]amino]-1,1-bis(4-chlorophenyl)ethanol (PubChem CID 1487207) has the molecular formula C18H21Cl2NO and a molecular weight of 338.28 g/mol. Its IUPAC name is 2-[[(2R)-butan-2-yl]amino]-1,1-bis(4-chlorophenyl)ethanol.
| Compound Name | 2-[[(2R)-butan-2-yl]amino]-1,1-bis(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 1487207 |
| Molecular Formula | C18H21Cl2NO |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-[[(2R)-butan-2-yl]amino]-1,1-bis(4-chlorophenyl)ethanol |
| SMILES | CC[C@@H](C)NCC(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21Cl2NO/c1-3-13(2)21-12-18(22,14-4-8-16(19)9-5-14)15-6-10-17(20)11-7-15/h4-11,13,21-22H,3,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | BQRBPWDQFAYRAI-CYBMUJFWSA-N |
| XLogP | 4.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |