C18H22Cl2NO+ — CID 7091513
[2,2-bis(4-chlorophenyl)-2-hydroxyethyl]-[(2S)-butan-2-yl]azanium (PubChem CID 7091513) has the molecular formula C18H22Cl2NO+ and a molecular weight of 339.29 g/mol. Its IUPAC name is [2,2-bis(4-chlorophenyl)-2-hydroxyethyl]-[(2S)-butan-2-yl]azanium.
| Compound Name | [2,2-bis(4-chlorophenyl)-2-hydroxyethyl]-[(2S)-butan-2-yl]azanium |
|---|---|
| PubChem CID | 7091513 |
| Molecular Formula | C18H22Cl2NO+ |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [2,2-bis(4-chlorophenyl)-2-hydroxyethyl]-[(2S)-butan-2-yl]azanium |
| SMILES | CC[C@H](C)[NH2+]CC(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21Cl2NO/c1-3-13(2)21-12-18(22,14-4-8-16(19)9-5-14)15-6-10-17(20)11-7-15/h4-11,13,21-22H,3,12H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | BQRBPWDQFAYRAI-ZDUSSCGKSA-O |
| XLogP | 3.59 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |