C27H30N2O3 — CID 148730012
3-methoxy-N-[4-[3-(5-methylhexanoyl)anilino]phenyl]benzamide (PubChem CID 148730012) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-methoxy-N-[4-[3-(5-methylhexanoyl)anilino]phenyl]benzamide.
| Compound Name | 3-methoxy-N-[4-[3-(5-methylhexanoyl)anilino]phenyl]benzamide |
|---|---|
| PubChem CID | 148730012 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 3-methoxy-N-[4-[3-(5-methylhexanoyl)anilino]phenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(Nc3cccc(C(=O)CCCC(C)C)c3)cc2)c1 |
| InChI | InChI=1S/C27H30N2O3/c1-19(2)7-4-12-26(30)20-8-5-10-24(17-20)28-22-13-15-23(16-14-22)29-27(31)21-9-6-11-25(18-21)32-3/h5-6,8-11,13-19,28H,4,7,12H2,1-3H3,(H,29,31) |
| InChIKey | OATVODJQCQMIBS-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |