C32H27F6N3O2 — CID 148730428
(4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-[3-(4-ethoxyphenyl)-2-pyridinyl]pentan-2-one (PubChem CID 148730428) has the molecular formula C32H27F6N3O2 and a molecular weight of 599.58 g/mol. Its IUPAC name is (4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-[3-(4-ethoxyphenyl)-2-pyridinyl]pentan-2-one.
| Compound Name | (4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-[3-(4-ethoxyphenyl)-2-pyridinyl]pentan-2-one |
|---|---|
| PubChem CID | 148730428 |
| Molecular Formula | C32H27F6N3O2 |
| Molecular Weight | 599.58 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | (4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-[3-(4-ethoxyphenyl)-2-pyridinyl]pentan-2-one |
| SMILES | CCOc1ccc(-c2cccnc2[C@@H](CC(=O)Cn2nc(C(F)F)c3c2C(F)(F)C2CC32)Cc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C32H27F6N3O2/c1-2-43-23-7-5-18(6-8-23)24-4-3-9-39-28(24)19(10-17-11-20(33)14-21(34)12-17)13-22(42)16-41-30-27(29(40-41)31(35)36)25-15-26(25)32(30,37)38/h3-9,11-12,14,19,25-26,31H,2,10,13,15-16H2,1H3/t19-,25?,26?/m1/s1 |
| InChIKey | OAVUSIHTGJHQBG-ILPVEIHGSA-N |
| XLogP | 7.75 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.58 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |