C20H23NO — CID 148732375
(Z)-1-[2-amino-5-[(E)-2-(4-methylphenyl)ethenyl]phenyl]pent-3-en-1-ol (PubChem CID 148732375) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (Z)-1-[2-amino-5-[(E)-2-(4-methylphenyl)ethenyl]phenyl]pent-3-en-1-ol.
| Compound Name | (Z)-1-[2-amino-5-[(E)-2-(4-methylphenyl)ethenyl]phenyl]pent-3-en-1-ol |
|---|---|
| PubChem CID | 148732375 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (Z)-1-[2-amino-5-[(E)-2-(4-methylphenyl)ethenyl]phenyl]pent-3-en-1-ol |
| SMILES | C/C=C\CC(O)c1cc(/C=C/c2ccc(C)cc2)ccc1N |
| InChI | InChI=1S/C20H23NO/c1-3-4-5-20(22)18-14-17(12-13-19(18)21)11-10-16-8-6-15(2)7-9-16/h3-4,6-14,20,22H,5,21H2,1-2H3/b4-3-,11-10+ |
| InChIKey | OBFOJBTUIDYGCD-CSWDMDPZSA-N |
| XLogP | 4.75 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|