About 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one
3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one (PubChem CID 1487330) has the molecular formula C17H19N3O
and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one |
| PubChem CID | 1487330 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one |
| SMILES | CCCn1c(-c2ccc[nH]c2=O)nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C17H19N3O/c1-4-8-20-15-10-12(3)11(2)9-14(15)19-16(20)13-6-5-7-18-17(13)21/h5-7,9-10H,4,8H2,1-3H3,(H,18,21) |
| InChIKey | KLBOPMHPTPLEGD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one?
The IUPAC name of 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one (CID 1487330) is 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one.
What is the SMILES notation for 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one?
The canonical SMILES for 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one is CCCn1c(-c2ccc[nH]c2=O)nc2cc(C)c(C)cc21.
What is the InChIKey of 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one?
The InChIKey is KLBOPMHPTPLEGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O/c1-4-8-20-15-10-12(3)11(2)9-14(15)19-16(20)13-6-5-7-18-17(13)21/h5-7,9-10H,4,8H2,1-3H3,(H,18,21).
What are the key properties of 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one?
3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one has a molecular weight of 281.36 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dimethyl-1-propylbenzimidazol-2-yl)-1H-pyridin-2-one is sourced from PubChem (CID 1487330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).