C30H26F2IN7O — CID 148735450
(11R,15S)-5-anilino-3-[[4-[5-[difluoro(iodo)methyl]-2-pyridinyl]phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one (PubChem CID 148735450) has the molecular formula C30H26F2IN7O and a molecular weight of 665.49 g/mol. Its IUPAC name is (11R,15S)-5-anilino-3-[[4-[5-[difluoro(iodo)methyl]-2-pyridinyl]phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one.
| Compound Name | (11R,15S)-5-anilino-3-[[4-[5-[difluoro(iodo)methyl]-2-pyridinyl]phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one |
|---|---|
| PubChem CID | 148735450 |
| Molecular Formula | C30H26F2IN7O |
| Molecular Weight | 665.49 g/mol |
| Exact Mass | 665.12 |
| IUPAC Name | (11R,15S)-5-anilino-3-[[4-[5-[difluoro(iodo)methyl]-2-pyridinyl]phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one |
| SMILES | CN1C(=O)c2c(Nc3ccccc3)nn(Cc3ccc(-c4ccc(C(F)(F)I)cn4)cc3)c2N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C30H26F2IN7O/c1-38-28(41)25-26(35-21-6-3-2-4-7-21)37-39(27(25)40-24-9-5-8-23(24)36-29(38)40)17-18-10-12-19(13-11-18)22-15-14-20(16-34-22)30(31,32)33/h2-4,6-7,10-16,23-24H,5,8-9,17H2,1H3,(H,35,37)/t23-,24+/m1/s1 |
| InChIKey | OBUNDFTUMZCTEY-RPWUZVMVSA-N |
| XLogP | 6.40 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|