C29H28N2O4 — CID 14873552
2-[4-[5-methoxy-2-(4-methoxyphenyl)-3-methylindol-1-yl]butyl]isoindole-1,3-dione (PubChem CID 14873552) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is 2-[4-[5-methoxy-2-(4-methoxyphenyl)-3-methylindol-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[5-methoxy-2-(4-methoxyphenyl)-3-methylindol-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 14873552 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 2-[4-[5-methoxy-2-(4-methoxyphenyl)-3-methylindol-1-yl]butyl]isoindole-1,3-dione |
| SMILES | COc1ccc(-c2c(C)c3cc(OC)ccc3n2CCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C29H28N2O4/c1-19-25-18-22(35-3)14-15-26(25)30(27(19)20-10-12-21(34-2)13-11-20)16-6-7-17-31-28(32)23-8-4-5-9-24(23)29(31)33/h4-5,8-15,18H,6-7,16-17H2,1-3H3 |
| InChIKey | QRNOTWGJYLSJDN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|